CymitQuimica logo

CAS 6975-44-6

:

4,6-Dihydroxynicotinic Acid Ethyl Ester

Description:
4,6-Dihydroxynicotinic Acid Ethyl Ester, with the CAS number 6975-44-6, is an organic compound derived from nicotinic acid. It features a pyridine ring with hydroxyl groups at the 4 and 6 positions, which contribute to its chemical reactivity and solubility. This compound is typically characterized by its ability to form hydrogen bonds due to the presence of hydroxyl groups, enhancing its solubility in polar solvents. It is often used in biochemical research and pharmaceutical applications, particularly in studies related to nicotinic receptors and as a potential precursor in the synthesis of various bioactive molecules. The ethyl ester functionality can influence its lipophilicity, making it more suitable for certain biological applications. Additionally, the compound may exhibit antioxidant properties, which can be beneficial in various therapeutic contexts. Overall, 4,6-Dihydroxynicotinic Acid Ethyl Ester is a versatile compound with significant implications in medicinal chemistry and biochemistry.
Formula:C8H9NO4
InChI:InChI=1/C8H9NO4/c1-2-13-8(12)5-4-9-7(11)3-6(5)10/h3-4H,2H2,1H3,(H2,9,10,11)
InChI key:QDHHLXABEXNRJX-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cnc(cc1O)O
Synonyms:
  • 1,6-Dihydro-4-hydroxy-6-oxo-3-pyridinecarboxylic acid ethyl ester
  • Ethyl 6-Hydroxy-4-Oxo-1,4-Dihydropyridine-3-Carboxylate
  • Ethyl 4,6-dihydroxynicotinate
Found 6 products.