CAS 69781-93-7

[2-(2-methylphenoxy)ethyl]hydrazinium chloride

Description:

[2-(2-methylphenoxy)ethyl]hydrazinium chloride, with the CAS number 69781-93-7, is a chemical compound characterized by its hydrazinium functional group, which is linked to a 2-(2-methylphenoxy)ethyl moiety. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the presence of the hydrazinium group and the chloride ion. It may exhibit properties such as hygroscopicity, which means it can absorb moisture from the air. The presence of the aromatic 2-methylphenoxy group suggests potential applications in organic synthesis or as a building block in pharmaceuticals. Additionally, compounds containing hydrazinium groups are often studied for their biological activities, including potential antitumor or antimicrobial properties. However, specific reactivity and stability can vary based on environmental conditions and the presence of other chemical species. As with many hydrazine derivatives, caution is advised due to potential toxicity and the need for proper handling and storage protocols.

Formula: C₉H₁₅ClN₂O

InChI: InChI=1/C9H14N2O.ClH/c1-8-4-2-3-5-9(8)12-7-6-11-10;/h2-5,11H,6-7,10H2,1H3;1H

SMILES: Cc1ccccc1OCCNN.Cl

[2-(2-Methylphenoxy)ethyl]hydrazine hydrochloride

CAS: 69781-93-7

Versatile small molecule scaffold

Formula: C₉H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 202.68 g/mol

Ref: 3D-UCA78193