CAS 698-16-8
:alpha-Chlorobenzaldoxime
Description:
Alpha-Chlorobenzaldoxime, with the CAS number 698-16-8, is an organic compound characterized by its oxime functional group attached to a chlorobenzaldehyde structure. It typically appears as a crystalline solid and is known for its pale yellow to white color. The compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water. Alpha-Chlorobenzaldoxime exhibits properties that make it useful in various chemical syntheses, particularly in the preparation of other organic compounds and as an intermediate in the production of agrochemicals and pharmaceuticals. It can participate in reactions such as condensation and nucleophilic substitution due to the presence of the reactive oxime group. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C7H6ClNO
InChI:InChI=1/C7H6ClNO/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H/b9-7+
Synonyms:- (Z)-N-hydroxybenzimidoyl chloride
- N-hydroxybenzenecarboximidoyl chloride
- 1-(2-chlorophenyl)-N-hydroxymethanimine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenecarboximidoyl chloride, N-hydroxy-
CAS:Formula:C7H6ClNOPurity:95%Color and Shape:SolidMolecular weight:155.5816α-chlorobenzaldoxime
CAS:α-chlorobenzaldoximeFormula:C7H6ClNOPurity:≥95%Color and Shape: off-white crystals/ powderMolecular weight:155.58164g/mola-Chlorobenzaldoxime
CAS:a-Chlorobenzaldoxime is a potent antibacterial agent that inhibits bacterial growth by binding to the enzyme protein, thereby preventing the synthesis of essential proteins. It also has insecticidal activities. a-Chlorobenzaldoxime is an inorganic compound and is not metabolized by the body. This makes it an efficient method for treating bacterial infections.Formula:C7H6ClNOPurity:Min. 95%Molecular weight:155.58 g/mol




