CymitQuimica logo

CAS 698-17-9

:

1-Piperidinecarbodithioic acid, methyl ester

Description:
1-Piperidinecarbodithioic acid, methyl ester, with the CAS number 698-17-9, is an organic compound characterized by its piperidine ring structure and the presence of a carbodithioic acid functional group. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. It features a methyl ester group, which contributes to its reactivity and potential applications in organic synthesis. The presence of sulfur in the dithioic acid moiety imparts unique chemical properties, making it a useful intermediate in the synthesis of various organic compounds, including agrochemicals and pharmaceuticals. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on the context of its use. Safety data indicates that, like many sulfur-containing compounds, it should be handled with care due to potential irritant effects. Overall, 1-Piperidinecarbodithioic acid, methyl ester is a versatile compound with applications in chemical synthesis and research.
Formula:C7H13NS2
InChI:InChI=1S/C7H13NS2/c1-10-7(9)8-5-3-2-4-6-8/h2-6H2,1H3
InChI key:BXWXUCPVRKLZSJ-UHFFFAOYSA-N
SMILES:CSC(=S)N1CCCCC1
Found 4 products.