CAS 698-26-0
:5-Chloro-1H-indazole
Description:
5-Chloro-1H-indazole is a heterocyclic organic compound characterized by its indazole structure, which consists of a fused benzene and pyrazole ring. The presence of a chlorine atom at the 5-position of the indazole ring significantly influences its chemical properties and reactivity. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. The compound can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-withdrawing nature of the chlorine substituent. Additionally, 5-Chloro-1H-indazole can serve as a building block for the synthesis of more complex molecules in drug discovery and development. Safety data indicates that, like many chemical substances, it should be handled with care, following appropriate safety protocols to minimize exposure and risks.
Formula:C7H5ClN2
InChI:InChI=1/C7H5ClN2/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H,(H,9,10)
InChI key:InChIKey=FVNCILPDWNBPLK-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=CC1)NN=C2
Synonyms:- 1H-Indazole, 5-chloro-
- 5-Chloroindazole
- Brn 0003260
- Nsc 78434
- 5-Chloro (1H)Indazole
- 5-23-06-00175 (Beilstein Handbook Reference)
- 5-Chloro-1H-indazole
- 5-chloro-1H-indazole(SALTDATA: FREE)
- 5-chloro-1h-indazol
- 5-chloro-3a,7a-dihydro-1H-indazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA003MLQ
1g29.00€5g62.00€10g93.00€25g179.00€50g248.00€100g632.00€250gTo inquire100mg21.00€250mg25.00€5-Chloro-1H-indazole
CAS:5-Chloro-1H-indazole is a molecule that is structurally related to benzodiazepinones and has been shown to have serotoninergic activity. It was one of the first compounds in the benzodiazepinone class to be synthesized, and it was found to have potent cerebral effects in rats with frequencies between 2 and 6 GHz. 5-Chloro-1H-indazole has been synthesized by reacting 2,6-dichlorobenzoic acid with aniline in tetrahydrofuran (THF) solution, followed by reaction with chlorine gas. The synthesis was analysed using proton NMR spectroscopy and anions.Formula:C7H5ClN2Purity:Min. 95%Molecular weight:152.58 g/mol



