CAS 6980-11-6

7-chloro-3H-imidazo[4,5-b]pyridine

Description:

7-Chloro-3H-imidazo[4,5-b]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 7-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various functionalization, which can lead to derivatives with enhanced pharmacological properties. The compound is soluble in polar organic solvents and may exhibit moderate stability under standard laboratory conditions. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine substituent. Overall, 7-chloro-3H-imidazo[4,5-b]pyridine serves as a valuable scaffold in the synthesis of bioactive molecules and is studied for its potential applications in pharmaceuticals.

Formula: C₆H₄ClN₃

InChI: InChI=1/C6H4ClN3/c7-4-1-2-8-6-5(4)9-3-10-6/h1-3H,(H,8,9,10)

SMILES: c1cnc2c(c1Cl)nc[nH]2

Synonyms:

• 1H-imidazo[4,5-b]pyridine, 7-chloro-
• 7-Chloro-1H-imidazo[4,5-b]pyridine

7-Chloro-1H-imidazo[4,5-b]pyridine

CAS: 6980-11-6

Formula: C₆H₄ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA0039Q5

7-Chloro-1H-imidazo[4,5-b]pyridine

CAS: 6980-11-6

7-Chloro-1H-imidazo[4,5-b]pyridine

Purity: 95%

Molecular weight: 153.57g/mol

Ref: 54-OR301113

7-Chloro-1H-imidazo[4,5-b]pyridine

CAS: 6980-11-6

Formula: C₆H₄ClN₃

Purity: 95.0%

Color and Shape: Solid, Yellow solid

Molecular weight: 153.57

Ref: 10-F077391

7-Chloro-3H-imidazo[4,5-b]pyridine

Controlled Product

CAS: 6980-11-6

Formula: C₆H₄ClN₃

Color and Shape: Neat

Molecular weight: 153.57

Ref: TR-C367575