CAS 6980-25-2
:Swertiajaponin
Description:
Swertiajaponin, with the CAS number 6980-25-2, is a natural compound primarily derived from the plant Swertia japonica, which is known for its traditional medicinal uses. This compound belongs to the class of iridoid glycosides, characterized by a bicyclic structure and the presence of sugar moieties. Swertiajaponin exhibits various biological activities, including anti-inflammatory, antioxidant, and hepatoprotective effects, making it of interest in pharmacological research. Its chemical structure typically includes a glucose unit attached to an iridoid core, contributing to its solubility and reactivity. The compound is often studied for its potential therapeutic applications, particularly in the treatment of liver diseases and metabolic disorders. Additionally, Swertiajaponin may influence various signaling pathways, which further underscores its importance in medicinal chemistry. As with many natural products, the extraction and purification processes can affect its bioactivity, necessitating careful consideration in research and application.
Formula:C22H22O11
InChI:InChI=1S/C22H22O11/c1-31-13-6-14-16(11(26)5-12(32-14)8-2-3-9(24)10(25)4-8)19(28)17(13)22-21(30)20(29)18(27)15(7-23)33-22/h2-6,15,18,20-25,27-30H,7H2,1H3/t15-,18-,20+,21-,22+/m1/s1
InChI key:InChIKey=DLVLXOYLQKCAME-DGHBBABESA-N
SMILES:O(C)C1=C(C(O)=C2C(=C1)OC(=CC2=O)C3=CC(O)=C(O)C=C3)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- 2-(3,4-Dihydroxyphenyl)-6-β-<span class="text-smallcaps">D</span>-glucopyranosyl-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-6-β-<span class="text-smallcaps">D</span>-glucopyranosyl-5-hydroxy-7-methoxy-
- Flavone, 6-β-<span class="text-smallcaps">D</span>-glucopyranosyl-3′,4′,5-trihydroxy-7-methoxy-
- Leucanthoside
- Swertiajaponin
- Flavone, 6-β-D-glucopyranosyl-3′,4′,5-trihydroxy-7-methoxy-
- 2-(3,4-Dihydroxyphenyl)-6-β-D-glucopyranosyl-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-6-β-D-glucopyranosyl-5-hydroxy-7-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4H-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-6-β-D-glucopyranosyl-5 -hydroxy-7-methoxy-
CAS:Formula:C22H22O12Purity:99%Color and Shape:SolidMolecular weight:478.4029Swertiajaponin
CAS:Swertiajaponin possesses antimicrobial activity.Formula:C22H22O11Purity:99.85%Color and Shape:SolidMolecular weight:462.4Swertiajaponin
CAS:Formula:C22H22O11Purity:95%~99%Color and Shape:Yellow powderMolecular weight:462.407Swertiajaponin
CAS:Swertiajaponin is a natural bioactive compound, classified as a flavonoid glycoside, which is derived from the plant Swertia japonica. Swertia japonica, a member of the Gentianaceae family, is predominantly found in East Asia, where it has been traditionally used in herbal medicine. As with many bioactive compounds, swertiajaponin exhibits its pharmacological effects through various biochemical interactions, including antioxidant, anti-inflammatory, and hepatoprotective activities. It is known to modulate cellular pathways and free radical scavenging, contributing to its therapeutic potential.Formula:C22H22O11Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:462.4 g/mol





