CAS 6980-44-5
:Gibberellin A19
Description:
Gibberellin A19, with the CAS number 6980-44-5, is a plant hormone belonging to the gibberellin family, which plays a crucial role in regulating various growth processes in plants. It is a tetracyclic diterpenoid compound that influences seed germination, stem elongation, and flowering. Gibberellin A19 is particularly noted for its ability to promote cell division and elongation, leading to increased plant height and improved fruit development. This compound is synthesized in the plant's young tissues and is involved in breaking dormancy in seeds, facilitating the transition from vegetative to reproductive growth. Its application in agriculture can enhance crop yields and improve the quality of fruits and vegetables. Gibberellin A19 is typically used in controlled amounts, as excessive application can lead to undesirable growth patterns. The compound is soluble in organic solvents and has a relatively low toxicity profile, making it suitable for various agricultural applications. Overall, Gibberellin A19 is a vital component in plant growth regulation and agricultural practices.
Formula:C20H26O6
InChI:InChI=1S/C20H26O6/c1-11-8-19-9-20(11,26)7-4-12(19)18(10-21)6-3-5-17(2,16(24)25)14(18)13(19)15(22)23/h10,12-14,26H,1,3-9H2,2H3,(H,22,23)(H,24,25)/t12-,13+,14+,17+,18+,19-,20-/m0/s1
InChI key:InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-N
SMILES:C(O)(=O)[C@@H]1[C@]23[C@]([C@@]4(C=O)[C@]1([C@@](C(O)=O)(C)CCC4)[H])(CC[C@](O)(C2)C(=C)C3)[H]
Synonyms:- Bamboo gibberellin
- (1α,4aα,4bβ,10β)-4a-Formyl-7-hydroxy-1-methyl-8-methylenegibbane-1,10-dicarboxylic acid
- Gibbane-1,10-dicarboxylic acid, 4a-formyl-7-hydroxy-1-methyl-8-methylene-, (1α,4aα,4bβ,10β)-
- Gibberellin A19
- 4aα,4bβ-Gibbane-1α,10β-dicarboxylic acid, 4a-formyl-7-hydroxy-1-methyl-8-methylene-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
