CAS 69812-57-3
:3-(Aminocarbonyl)benzenesulfonyl chloride
Description:
3-(Aminocarbonyl)benzenesulfonyl chloride, with the CAS number 69812-57-3, is an organic compound characterized by the presence of both a sulfonyl chloride group and an aminocarbonyl group attached to a benzene ring. This compound typically appears as a white to light yellow solid and is known for its reactivity due to the sulfonyl chloride functional group, which can undergo nucleophilic substitution reactions. It is soluble in polar organic solvents, making it useful in various chemical syntheses. The aminocarbonyl group contributes to its potential applications in pharmaceuticals and agrochemicals, as it can serve as a building block for more complex molecules. Additionally, the compound may exhibit properties such as moderate stability under standard conditions but can decompose or react with moisture, releasing hydrochloric acid. Proper handling and storage in a dry environment are essential to maintain its integrity and reactivity. Overall, 3-(Aminocarbonyl)benzenesulfonyl chloride is a valuable intermediate in organic synthesis, particularly in the development of sulfonamide derivatives.
Formula:C7H6ClNO3S
InChI:InChI=1S/C7H6ClNO3S/c8-13(11,12)6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10)
InChI key:InChIKey=WXJXARCKFQHXST-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC(C(N)=O)=CC=C1
Synonyms:- 3-(Aminocarbonyl)benzenesulfonyl chloride
- 3-Carboxamidobenzenesulfonyl chloride
- Benzenesulfonyl chloride, 3-(aminocarbonyl)-
- 3-Carbamoylbenzenesulfonyl chloride
- 3-(Chlorosulfonyl)benzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-(aminocarbonyl)benzenesulfonyl chloride
CAS:<p>3-(aminocarbonyl)benzenesulfonyl chloride (3-ACBSCl) is a compound that inhibits the life cycle of the HIV virus. It is a hexamer and binds to viral proteins, inhibiting the process of viral assembly. 3-ACBSCl helps to optimize lead compounds for antiviral drugs. This inhibitor has been shown to be active against HIV-1, and also inhibits other viruses that have an analogous life cycle. 3-ACBSCl has been shown to inhibit HIV-1 infection by binding to the capsid protein and preventing it from assembling into a functional virus particle.</p>Formula:C7H6ClNO3SPurity:Min. 95%Molecular weight:219.64 g/mol
