CAS 69816-57-5
:N-{[5-(4-bromophenyl)-6-methylpyrazin-2-yl]carbamoyl}-2-chlorobenzamide
Description:
N-{[5-(4-bromophenyl)-6-methylpyrazin-2-yl]carbamoyl}-2-chlorobenzamide is a chemical compound characterized by its complex structure, which includes a pyrazine ring substituted with a bromophenyl group and a chlorobenzamide moiety. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential biological activity. The methyl group on the pyrazine ring contributes to its steric and electronic properties, while the carbamoyl group enhances its solubility and interaction with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with various biological pathways, and its unique substituents may confer specificity in targeting certain receptors or enzymes. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in drug development or other fields.
Formula:C19H14BrClN4O2
InChI:InChI=1/C19H14BrClN4O2/c1-11-17(12-6-8-13(20)9-7-12)22-10-16(23-11)24-19(27)25-18(26)14-4-2-3-5-15(14)21/h2-10H,1H3,(H2,23,24,25,26,27)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L 7063
CAS:<p>L 7063 is a bioactive chemical.</p>Formula:C19H14BrClN4O2Color and Shape:SolidMolecular weight:445.70
