CAS 69818-23-1
:4-methoxycyclohexa-3,5-diene-1,2-dione
Description:
4-Methoxycyclohexa-3,5-diene-1,2-dione, identified by its CAS number 69818-23-1, is an organic compound characterized by its unique bicyclic structure featuring a methoxy group and two carbonyl groups. This compound exhibits a conjugated diene system, which contributes to its potential reactivity and stability under various conditions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. The diketone functionality suggests that it may participate in tautomerization and can act as a versatile building block in organic synthesis. Additionally, the compound's structural features may impart interesting optical properties, making it relevant in materials science and photochemistry. Overall, 4-methoxycyclohexa-3,5-diene-1,2-dione is a compound of interest for further exploration in both synthetic and applied chemistry contexts.
Formula:C7H6O3
InChI:InChI=1/C7H6O3/c1-10-5-2-3-6(8)7(9)4-5/h2-4H,1H3
SMILES:COC1=CC(=O)C(=O)C=C1
Synonyms:- 3,5-Cyclohexadiene-1,2-Dione, 4-Methoxy-
- 4-Methoxy-1,2-benzoquinone
- 4-Methoxy-2-benzoquinone
- 4-Methoxy-3,5-cyclohexadiene-1,2-dione
- 4-Methoxy-o-benzoquinone
- 4-Methoxy-ortho-benzoquinone
- 4-Mob
- 69818-23-1
- 4-methoxycyclohexa-3,5-diene-1,2-dione
- Omeprazole Impurity 44
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
