CAS 69826-63-7
:[(naphthalen-2-ylcarbonyl)amino]acetate
Description:
The chemical substance known as [(naphthalen-2-ylcarbonyl)amino]acetate, with the CAS number 69826-63-7, is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a carbonyl group and an aminoacetate moiety. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the naphthalene group imparts hydrophobic characteristics, while the aminoacetate portion can engage in hydrogen bonding and ionic interactions, enhancing its solubility in polar solvents. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and ability to form complexes with metal ions. Additionally, it may serve as a building block for the synthesis of more complex molecules. As with many organic compounds, safety and handling precautions should be observed, as its specific toxicity and environmental impact would depend on concentration and exposure.
Formula:C13H10NO3
InChI:InChI=1/C13H11NO3/c15-12(16)8-14-13(17)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2,(H,14,17)(H,15,16)/p-1
SMILES:c1ccc2cc(ccc2c1)C(=NCC(=O)[O-])O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Naphthalen-2-ylformamido)acetic Acid-13C2,15N,D2
CAS:Controlled ProductFormula:C2C11D2H915NO3Color and Shape:NeatMolecular weight:234.2222-(Naphthalen-2-ylformamido)acetic acid
CAS:2-(Naphthalen-2-ylformamido)acetic acid (Nafamid) is a toxic agent that can be used to induce experimental diabetes in animals. Nafamid is metabolized to benzoate and then to chloride, which can be detected in urine. Chromatographic experiments showed that Nafamid was not metabolized by rats or mice, but was eliminated as the mercapturic acid (MNA) and mercapturic acid glucuronide (MAG). MNA has been isolated from urine samples of rats injected with Nafamid. The metabolic pathways for Nafamid are the same for animals and humans.Formula:C13H11NO3Purity:Min. 95%Molecular weight:229.23 g/mol


