CAS 698358-10-0
:allyl (3R,5R,6R)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxy-tetrahydropyran-2-carboxylate
Description:
Allyl (3R,5R,6R)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxy-tetrahydropyran-2-carboxylate is a complex organic compound characterized by its intricate molecular structure, which includes a tetrahydropyran ring, multiple hydroxyl groups, and an allyl ester functional group. The presence of the 2,6-dichloroanilino moiety suggests potential biological activity, possibly related to its interactions with specific receptors or enzymes. The compound's trihydroxy groups contribute to its polarity and solubility in polar solvents, while the carboxylate group may enhance its reactivity and ability to form salts. Its stereochemistry, indicated by the (3R,5R,6R) configuration, suggests specific spatial arrangements that could influence its biological activity and interactions. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C23H23Cl2NO8
InChI:InChI=1/C23H23Cl2NO8/c1-2-10-32-22(31)21-19(29)18(28)20(30)23(34-21)33-16(27)11-12-6-3-4-9-15(12)26-17-13(24)7-5-8-14(17)25/h2-9,18-21,23,26,28-30H,1,10-11H2/t18?,19-,20-,21?,23+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Diclofenac Acyl-β-D-glucuronide Allyl Ester
CAS:Controlled Product<p>Applications An intermediate for the synthesis of Diclofenac’s glucuronide metaoblite.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Kenny, J.R., et al.: J. Med. Chem., 47, 2816 (2004),<br></p>Formula:C23H23Cl2NO8Color and Shape:NeatMolecular weight:512.34


