CAS 69839-68-5

16-mercaptohexadecanoic acid

Description:

16-Mercaptohexadecanoic acid, with the CAS number 69839-68-5, is a long-chain fatty acid derivative characterized by the presence of a thiol (-SH) group at the terminal end of a hexadecanoic acid (palmitic acid) chain. This compound exhibits both hydrophobic and hydrophilic properties due to its long hydrocarbon tail and polar thiol group, making it amphiphilic. It is typically used in various applications, including surface modification, nanotechnology, and as a ligand in metal nanoparticle synthesis. The thiol group allows for strong binding to metal surfaces, facilitating the formation of self-assembled monolayers. Additionally, 16-mercaptohexadecanoic acid can participate in various chemical reactions, including oxidation and esterification, which can be exploited in organic synthesis and materials science. Its unique properties make it a valuable compound in research and industrial applications, particularly in the development of biosensors and drug delivery systems. Safety data should be consulted for handling, as thiol compounds can be reactive and may pose health risks.

Formula: C₁₆H₃₂O₂S

InChI: InChI=1/C16H32O2S/c17-16(18)14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-19/h19H,1-15H2,(H,17,18)

SMILES: C(CCCCCCCC(=O)O)CCCCCCCS

Synonyms:

• 16-Sulfanylhexadecanoic Acid

16-Mercaptohexadecanoic acid

CAS: 69839-68-5

Formula: C₁₆H₃₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 288.4891

Ref: IN-DA003DVN

16-Mercaptohexadecanoic Acid

CAS: 69839-68-5

16-Mercaptohexadecanoic Acid

Purity: 98%

Molecular weight: 288.49g/mol

Ref: 54-OR1027258

16-Mercaptohexadecanoic acid

CAS: 69839-68-5

Formula: C₁₆H₃₂O₂S

Purity: 97%

Molecular weight: 288.49

Ref: 10-F546560

16-Mercaptohexadecanoic acid

CAS: 69839-68-5

16-Mercaptohexadecanoic acid (16MHDA) is a fatty acid that has been shown to be an effective inhibitor of the enzyme fatty acid synthase. This enzyme is responsible for the synthesis of long-chain polyunsaturated fatty acids and their derivatives, which are key components of cell membranes and also act as signaling molecules. 16MHDA can be used in the treatment of diseases such as psoriasis, rheumatoid arthritis, and cancer. 16MHDA has been shown to have a high detection sensitivity and activity index when used in electrochemical impedance spectroscopy experiments. The x-ray diffraction data show that 16MHDA forms an acid complex with its substrate, which is thought to be the reaction mechanism. Colloidal gold has been used to study the interaction between 16MHDA and DNA duplexes. This compound was also found to have monoclonal antibody binding properties in human serum samples.

Formula: C₁₆H₃₂O₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 288.49 g/mol

Ref: 3D-FM31475