CAS 69839-80-1

(5xi)-2-{[(2-chloroethyl)(nitroso)carbamoyl]amino}-2-deoxy-L-lyxo-hexose

Description:

The chemical substance known as (5xi)-2-{[(2-chloroethyl)(nitroso)carbamoyl]amino}-2-deoxy-L-lyxo-hexose, with the CAS number 69839-80-1, is a modified sugar derivative that incorporates a nitroso group and a chloroethyl moiety. This compound is characterized by its structural complexity, featuring a hexose backbone with specific stereochemistry at the 2-deoxy position. The presence of the chloroethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions, while the nitroso group may impart unique chemical properties, including the ability to participate in redox reactions. The carbamoyl group indicates that the compound may exhibit biological activity, potentially interacting with biological macromolecules. Such modifications can influence the compound's solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug design. Overall, this substance exemplifies the intersection of carbohydrate chemistry and medicinal applications, warranting further investigation into its properties and potential uses.

Formula: C₉H₁₆ClN₃O₇

InChI: InChI=1/C9H16ClN3O7/c10-1-2-13(12-20)9(19)11-5(3-14)7(17)8(18)6(16)4-15/h3,5-8,15-18H,1-2,4H2,(H,11,19)/t5-,6?,7-,8-/m0/s1

L-Chlorozotocin

CAS: 69839-80-1

L-Chlorozotocin is a glucose-linked chloroethyl nitrosourea with potential antineoplastic activity.

Formula: C₉H₁₆ClN₃O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 313.69

Ref: TM-T24392