CAS 69843-13-6
:1-methyl-1H-pyrazol-4-amine
Description:
1-Methyl-1H-pyrazol-4-amine, with the CAS number 69843-13-6, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a methyl group at the 1-position and an amino group at the 4-position of the pyrazole ring, contributing to its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry and agricultural chemistry, where it may serve as a building block for the synthesis of more complex molecules or as a potential active ingredient in pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions, making it essential to refer to specific data sheets for detailed information.
Formula:C4H7N3
InChI:InChI=1/C4H7N3/c1-7-3-4(5)2-6-7/h2-3H,5H2,1H3
SMILES:Cn1cc(cn1)N
Synonyms:- 1H-Pyrazol-4-amine, 1-methyl-
- 1-Methyl-1H-Pyrazol-4-Ylamine
- 4-Amino-1-methylpyrazole
- 1-Methyl-1H-pyrazol-4-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methyl-1H-pyrazol-4-ylamine
CAS:Formula:C4H7N3Purity:97%Color and Shape:Liquid, SolidMolecular weight:97.1214-Amino-1-methyl-1H-pyrazole, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H7N3Purity:95%Color and Shape:Dark brown or purple or dark purple, Crystals or powder or crystalline powder or lumps or chunksMolecular weight:97.121-Methyl-1H-pyrazol-4-amine
CAS:Formula:C4H7N3Purity:97%Color and Shape:SolidMolecular weight:97.1185Ref: IN-DA003KNP
500gTo inquire250mg20.00€1g24.00€5g25.00€10g43.00€25g66.00€50g127.00€100g200.00€250g352.00€1-Methyl-1H-pyrazol-4-amine
CAS:1-Methyl-1H-pyrazol-4-amineFormula:C4H7N3Purity:97%Color and Shape: pale red liquidMolecular weight:97.12g/mol



