
CAS 69852-45-5
:3-[[3-(Dimethylamino)propyl]amino]propanenitrile
Description:
3-[[3-(Dimethylamino)propyl]amino]propanenitrile, with the CAS number 69852-45-5, is an organic compound characterized by its structure, which includes a propanenitrile group and a dimethylamino substituent. This compound typically exhibits properties associated with amines and nitriles, such as being polar and potentially soluble in polar solvents like water and alcohols. The presence of the dimethylamino group suggests it may have basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the nitrile functional group can engage in reactions typical of nitriles, such as hydrolysis to form carboxylic acids. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-[[3-(Dimethylamino)propyl]amino]propanenitrile is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C8H17N3
InChI:InChI=1S/C8H17N3/c1-11(2)8-4-7-10-6-3-5-9/h10H,3-4,6-8H2,1-2H3
InChI key:InChIKey=YALMGFWDBZZMMB-UHFFFAOYSA-N
SMILES:C(NCCC#N)CCN(C)C
Synonyms:- 3-[[3-(Dimethylamino)propyl]amino]propiononitrile
- 3-[[3-(Dimethylamino)propyl]amino]propanenitrile
- Propanenitrile, 3-[[3-(dimethylamino)propyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.