CAS 69852-49-9

Propanamide, 3-[[3-(dimethylamino)propyl]amino]-

Description:

Propanamide, 3-[[3-(dimethylamino)propyl]amino]- is an organic compound characterized by its amide functional group, which is indicative of its potential as a polar molecule. The presence of the dimethylamino group suggests that it has basic properties, allowing it to participate in hydrogen bonding and interact with various biological systems. This compound typically exhibits moderate solubility in polar solvents due to its amide structure, while its hydrophobic propyl chain may impart some lipophilicity. The molecular structure indicates that it may act as a ligand or a building block in the synthesis of more complex molecules, potentially serving roles in pharmaceuticals or agrochemicals. Its CAS number, 69852-49-9, allows for precise identification in chemical databases. Safety data sheets would provide essential information regarding its handling, storage, and potential hazards, which is crucial for laboratory and industrial applications. Overall, the compound's unique structural features contribute to its reactivity and potential applications in various fields of chemistry and biochemistry.

Formula: C₈H₁₉N₃O

InChI: InChI=1S/C8H19N3O/c1-11(2)7-3-5-10-6-4-8(9)12/h10H,3-7H2,1-2H3,(H2,9,12)

InChI key: InChIKey=NBANCPUCRZJYPJ-UHFFFAOYSA-N

SMILES: C(CN(C)C)CNCCC(N)=O

Synonyms:

• 3-[[3-(Dimethylamino)propyl]amino]propanamide
• Propanamide, 3-[[3-(dimethylamino)propyl]amino]-

3-([3-(Dimethylamino)propyl]amino)propanamide

CAS: 69852-49-9

Versatile small molecule scaffold

Formula: C₈H₁₉N₃O

Purity: Min. 95%

Molecular weight: 173.26 g/mol

Ref: 3D-UCA85249