CAS 69872-17-9

4-bromo-1H-pyrrolo[2,3-c]pyridine

Description:

4-Bromo-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 4-position of the pyrrole ring enhances its reactivity and can influence its biological activity. This compound typically exhibits a planar structure, allowing for effective π-π stacking interactions, which can be significant in biological systems and material science applications. It is generally soluble in organic solvents, making it suitable for various synthetic applications. The compound may serve as an important intermediate in the synthesis of pharmaceuticals and agrochemicals, owing to its potential biological activity. Additionally, its structural features may allow for interactions with various biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-bromo-1H-pyrrolo[2,3-c]pyridine is a versatile compound with potential applications in research and industry.

Formula: C₇H₅BrN₂

InChI: InChI=1/C7H5BrN2/c8-6-3-9-4-7-5(6)1-2-10-7/h1-4,10H

SMILES: C1=CNC2=CN=CC(=C12)Br

Synonyms:

• 4-Bromo-6-Azaindole

4-bromo-1H-pyrrolo[2,3-c]pyridine

CAS: 69872-17-9

Formula: C₇H₅BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 197.0320

Ref: IN-DA0038H7

4-Bromo-6-azaindole

CAS: 69872-17-9

4-Bromo-6-azaindole

Formula: C₇H₅BrN₂

Purity: 97%

Color and Shape: white to light brown solid

Molecular weight: 197.03g/mol

Ref: 54-OR55212

4-Bromo-1H-pyrrolo[2,3-c]pyridine

CAS: 69872-17-9

Formula: C₇H₅BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.035

Ref: 10-F092788