CAS 69877-38-9
:(2E,4E)-5-(4-Methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienal
Description:
The chemical substance known as (2E,4E)-5-(4-Methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienal, with the CAS number 69877-38-9, is an organic compound characterized by its complex structure, which includes a conjugated diene system and a methoxy-substituted aromatic ring. This compound features a pentadienal backbone, indicating the presence of both double bonds and an aldehyde functional group. The methoxy group contributes to its polarity and can influence its reactivity and solubility in various solvents. The presence of multiple methyl groups on the aromatic ring enhances its hydrophobic character and may affect its biological activity. Such compounds often exhibit interesting optical properties and can be involved in various chemical reactions, including electrophilic substitutions and polymerizations. Additionally, due to its structural features, it may have applications in fields such as organic synthesis, materials science, or as a potential bioactive agent. Understanding its properties requires further investigation into its reactivity, stability, and potential applications in different chemical contexts.
Formula:C16H20O2
InChI:InChI=1/C16H20O2/c1-11(8-9-17)6-7-15-12(2)10-16(18-5)14(4)13(15)3/h6-10H,1-5H3/b7-6+,11-8+
Synonyms:- 2,4-pentadienal, 5-(4-methoxy-2,3,6-trimethylphenyl)-3-methyl-, (2E,4E)-
- 5-(4-Methoxy-2,3,6-trimethylphenyl)-3-methyl-,(2E,4E)-2,4-pentadienal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2E,4E)-5-(4-Methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienal
CAS:Formula:C16H20O2Molecular weight:244.3288
