CAS 69879-22-7

6-aminopyridine-3-carbaldehyde

Description:

6-Aminopyridine-3-carbaldehyde, with the CAS number 69879-22-7, is an organic compound characterized by its pyridine ring structure, which is substituted with an amino group and an aldehyde functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the amino group contributes to its basicity and reactivity, while the aldehyde group allows for various chemical transformations, such as condensation reactions. 6-Aminopyridine-3-carbaldehyde can participate in nucleophilic addition reactions and is often used as an intermediate in the synthesis of more complex molecules, including pharmaceuticals. Its solubility in polar solvents, such as water and alcohols, makes it versatile for various laboratory applications. Additionally, the compound's structure may influence its biological activity, making it a subject of interest in drug discovery and development. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₆N₂O

InChI: InChI=1/C6H6N2O/c7-6-2-1-5(4-9)3-8-6/h1-4H,(H2,7,8)

SMILES: c1cc(=N)[nH]cc1C=O

Synonyms:

• 3-Pyridinecarboxaldehyde, 6-Amino-
• 6-Aminonicotinaldehyde

6-Aminonicotinaldehyde

CAS: 69879-22-7

Formula: C₆H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 122.1246

Ref: IN-DA0065S2

6-Aminonicotinaldehyde

CAS: 69879-22-7

Formula: C₆H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 122.127

Ref: 10-F241082

6-Aminonicotinaldehyde

CAS: 69879-22-7

6-Aminonicotinaldehyde

Purity: 95%

Molecular weight: 122.12g/mol

Ref: 54-OR923967

6-Aminonicotinaldehyde

CAS: 69879-22-7

Formula: C₆H₆N₂O

Molecular weight: 122.13

Ref: 4Z-P-142148

6-Aminopyridine-3-carboxaldehyde

Controlled Product

CAS: 69879-22-7

Applications 6-Aminopyridine-3-carboxaldehyde is a novel ribonucleotide reductase inhibitor that belongs to the class of metal-binding site affecting ribonucleotide inhibitors that are derivatives of alpa-heterocyclic carboxaldehyde thiosemicarbazone.
References Lynn, F., et al.: Cancer. Chemother. Pharmacol., 50, 223 (2002);

Formula: C₆H₆N₂O

Color and Shape: Neat

Molecular weight: 122.125

Ref: TR-A629030