CAS 69879-23-8

6-Hydrazinonicotinamide

Description:

6-Hydrazinonicotinamide, with the CAS number 69879-23-8, is a chemical compound that belongs to the class of hydrazine derivatives. It is characterized by the presence of a hydrazine functional group attached to a nicotinamide structure, which is derived from niacin (vitamin B3). This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. Its structure allows it to participate in various chemical reactions, particularly those involving hydrazine chemistry, which can include redox reactions and the formation of hydrazones. 6-Hydrazinonicotinamide has garnered interest in medicinal chemistry due to its potential biological activities, including anti-tumor and anti-inflammatory properties. Additionally, it may serve as a precursor in the synthesis of other bioactive compounds. As with many hydrazine derivatives, handling precautions are advised due to potential toxicity and reactivity.

Formula: C₆H₈N₄O

InChI: InChI=1S/C6H8N4O/c7-6(11)4-1-2-5(10-8)9-3-4/h1-3H,8H2,(H2,7,11)(H,9,10)

InChI key: InChIKey=XHNXJRVXHHTIKS-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1C=CC(=NN)NC1

Synonyms:

• HYNIC
• 3-Pyridinecarboxamide, 6-hydrazinyl-
• 3-Pyridinecarboxamide, 6-hydrazino-
• 6-Hydrazinyl-3-pyridinecarboxamide
• 6-Hydrazinonicotinamide

6-Hydrazinylpyridine-3-carboxamide

CAS: 69879-23-8

6-Hydrazinylpyridine-3-carboxamide is a coligand with high affinity for technetium, which is used in analytical chemistry. The compound has been shown to bind to the transcription-polymerase chain reaction (PCR) and monoclonal antibody binding sites of the human immunodeficiency virus type 1 (HIV-1). 6-Hydrazinylpyridine-3-carboxamide has also been shown to be an effective inhibitor of protein synthesis in animal cells and to inhibit tumor cell growth. Clinical trials have demonstrated that this compound can be used as an aneurysm sealant and as a cancer treatment.

Formula: C₆H₈N₄O

Purity: Min. 95%

Molecular weight: 152.15 g/mol

Ref: 3D-UCA87923