CAS 6988-19-8
:2-(1,3-dioxolan-2-yl)phenol
Description:
2-(1,3-Dioxolan-2-yl)phenol, with the CAS number 6988-19-8, is an organic compound characterized by its phenolic structure combined with a dioxolane ring. This compound typically exhibits properties associated with both phenols and cyclic ethers. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the hydroxyl (-OH) group in the phenolic part contributes to its potential as a hydrogen bond donor, enhancing its solubility in polar solvents. The dioxolane ring adds to its stability and may influence its reactivity, making it useful in various chemical syntheses and applications. Additionally, compounds like this can exhibit biological activity, which may be of interest in pharmaceutical research. Its unique structure allows for potential applications in materials science, particularly in the development of polymers or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c10-8-4-2-1-3-7(8)9-11-5-6-12-9/h1-4,9-10H,5-6H2
SMILES:c1ccc(c(c1)C1OCCO1)O
Synonyms:- 2-(2-Hydroxyphenyl)-1,3-dioxolane
- Phenol, 2-(1,3-dioxolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(1,3-Dioxolan-2-yl)phenol
CAS:Controlled ProductFormula:C9H10O3Color and Shape:NeatMolecular weight:166.174
