CAS 6988-55-2
:2,6-dideoxy-D-arabino-hexose
Description:
2,6-Dideoxy-D-arabino-hexose, with the CAS number 6988-55-2, is a monosaccharide characterized by its unique structure, which includes a six-carbon backbone with two hydroxyl groups replaced by hydrogen atoms, making it a deoxy sugar. This compound is part of the family of hexoses and is specifically an aldose, meaning it contains an aldehyde group. Its configuration is based on the D-arabino form, which influences its stereochemistry and biological interactions. The absence of hydroxyl groups at the 2 and 6 positions contributes to its distinct properties, including solubility in water and potential reactivity in glycosylation reactions. 2,6-Dideoxy-D-arabino-hexose can be involved in various biochemical pathways and may serve as a building block for more complex carbohydrates or glycosides. Its derivatives are of interest in medicinal chemistry and biochemistry due to their potential applications in drug development and as intermediates in synthetic pathways. Overall, this compound exemplifies the diversity and complexity of carbohydrate chemistry.
Formula:C6H12O4
InChI:InChI=1/C6H12O4/c1-4(8)6(10)5(9)2-3-7/h3-6,8-10H,2H2,1H3/t4-,5-,6-/m1/s1
SMILES:C[C@H]([C@H]([C@@H](CC=O)O)O)O
Synonyms:- 2,6-dideoxy-D-altrose
- 2,6-Dideoxy-D-glucose
- 6988-55-2
- Altrose, 2,6-dideoxy-, D-
- Chromose C
- D-arabino-hexose, 2,6-dideoxy-
- D-Canarose
- D-Olivose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,6-Dideoxy-D-glucose
CAS:2,6-Dideoxy-D-glucose is a glycosyl acceptor that has been shown to induce apoptosis in cancer cells. It is an anticancer agent that inhibits the production of ATP by inhibiting glycolysis. 2,6-Dideoxy-D-glucose can also inhibit the translocation of proteins from the cytoplasm to the nucleus and thereby prevent nuclear accumulation of these proteins. This drug may also have anticancer effects through its ability to inhibit DNA synthesis and potentiate anticancer effects of other chemotherapeutic agents. 2,6-Dideoxy-D-glucose has been shown to be effective against cardiac cancer cells and leukemia cells.Formula:C6H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:148.16 g/mol

