CAS 69880-85-9
:(4S,5S)-4-amino-6-(hydroxymethyl)tetrahydropyran-2,3,5-triol hydrochloride
Description:
(4S,5S)-4-amino-6-(hydroxymethyl)tetrahydropyran-2,3,5-triol hydrochloride is a chemical compound characterized by its tetrahydropyran structure, which features a six-membered ring containing oxygen. This compound has multiple functional groups, including an amino group and hydroxymethyl groups, contributing to its reactivity and potential biological activity. The presence of stereocenters at the 4 and 5 positions indicates that it exists in specific stereoisomeric forms, which can significantly influence its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. This compound is of interest in medicinal chemistry, particularly in the development of therapeutics, due to its structural features that may interact with biological targets. Its CAS number, 69880-85-9, allows for precise identification in chemical databases and literature. Overall, the unique structural characteristics and functional groups of this compound make it a subject of interest in various fields, including drug development and biochemistry.
Formula:C6H14ClNO5
InChI:InChI=1/C6H13NO5.ClH/c7-3-4(9)2(1-8)12-6(11)5(3)10;/h2-6,8-11H,1,7H2;1H/t2?,3-,4+,5?,6?;/m0./s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-3-deoxy-D-mannose hydrochloride
CAS:3-Amino-3-deoxy-D-mannose hydrochloridePurity:≥95%Molecular weight:215.63g/mol3-Amino-3-deoxy-D-mannose Hydrochloride
CAS:Controlled ProductStability Hygroscopic
Applications 3-Amino-3-deoxy-D-mannose Hydrochloride (cas# 69880-85-9) is a compound useful in organic synthesis.Formula:C6H13NO5·ClHColor and Shape:NeatMolecular weight:215.633-Amino-3-deoxy-D-mannose HCl
CAS:3-Amino-3-deoxy-D-mannose HCl is a synthetic, fluorinated monosaccharide. It is a complex carbohydrate that can be found in glycosylations and polysaccharides. 3-Amino-3-deoxy-D-mannose HCl is synthesized through the use of Click chemistry and methylation methods. 3-Amino-3-deoxy-D-mannose HCl is used as a sugar modification for glycoconjugates and proteins, which are natural substances made up of sugars. This product has been purified to high purity standards and can be used in a variety of applications, including pharmaceuticals, biotechnology, diagnostics, and cell biology.Formula:C6H13NO5·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:215.63 g/mol



