CymitQuimica logo

CAS 69884-05-5

:

4-Hydroxy-7-methoxy-1,4-benzoxazinone

Description:
4-Hydroxy-7-methoxy-1,4-benzoxazinone, with the CAS number 69884-05-5, is an organic compound belonging to the class of benzoxazinones, which are known for their diverse biological activities. This compound features a benzene ring fused with a 1,4-oxazinone structure, characterized by the presence of a hydroxy group at the 4-position and a methoxy group at the 7-position. These functional groups contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit solubility in organic solvents. Its structure suggests potential antioxidant and anti-inflammatory properties, which have been explored in various studies. Additionally, benzoxazinones are known for their role in plant defense mechanisms, indicating that this compound may also have ecological significance. Overall, 4-Hydroxy-7-methoxy-1,4-benzoxazinone is a compound of interest for further research due to its unique structural features and potential applications.
Formula:C9H9NO4
InChI:InChI=1S/C9H9NO4/c1-13-6-2-3-7-8(4-6)14-5-9(11)10(7)12/h2-4,12H,5H2,1H3
InChI key:InChIKey=AFMLVQPDSTZQOF-UHFFFAOYSA-N
SMILES:ON1C=2C(=CC(OC)=CC2)OCC1=O
Synonyms:
  • 4-Hydroxy-7-methoxy-1,4-benzoxazinone
  • 4-Hydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one
  • 2H-1,4-Benzoxazin-3(4H)-one, 4-hydroxy-7-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.