CAS 69888-86-4: Tetradecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester
Description:Tetradecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester, also known as a derivative of tetradecanoic acid (myristic acid), is an organic compound characterized by its ester functional group and a pyrrolidine ring. This compound features a long hydrocarbon chain, which contributes to its hydrophobic properties, while the ester and pyrrolidine components introduce polar characteristics. The presence of the dioxo group indicates that there are two carbonyl functionalities within the molecule, which can influence its reactivity and interactions with other substances. Typically, such compounds may exhibit biological activity, potentially serving as intermediates in synthetic pathways or as bioactive agents. The molecular structure suggests that it may have applications in pharmaceuticals, agrochemicals, or as a surfactant, depending on its specific properties and behavior in various environments. As with many organic compounds, its solubility, melting point, and stability can vary based on environmental conditions and the presence of other chemical species.
Formula:C18H31NO4
InChI:InChI=1S/C18H31NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-18(22)23-19-16(20)14-15-17(19)21/h2-15H2,1H3
InChI key:InChIKey=NZEDHZOVUDEBGW-UHFFFAOYSA-N
SMILES:O=C(ON1C(=O)CCC1=O)CCCCCCCCCCCCC
- Synonyms:
- 1-(Tetradecanoyloxy)Pyrrolidine-2,5-Dione
- 2,5-Dioxopyrrolidin-1-yl tetradecanoate
- 2,5-Pyrrolidinedione, 1-[(1-oxotetradecyl)oxy]-
- N-Hydroxysuccinimide myristate
- Succinimidyl tetradecanoate
- Tetradecanoic acid N-hydroxysuccinimide ester
- Tetradecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester
- Myristic acid N-hydroxysuccinimide ester
