CAS 6989-21-5
:Atractylon
Description:
Atractylon, with the CAS number 6989-21-5, is a chemical compound primarily derived from various plant sources, particularly those in the Asteraceae family. It is known for its unique structure, which includes a bicyclic framework that contributes to its biological activity. Atractylon exhibits a range of pharmacological properties, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in medicinal chemistry and natural product research. The compound is often studied for its role in traditional medicine and its potential therapeutic applications. In terms of physical properties, Atractylon is typically characterized by its solubility in organic solvents, though specific solubility characteristics can vary based on the solvent used. Its stability and reactivity can also be influenced by environmental conditions such as temperature and pH. Overall, Atractylon represents a fascinating subject for further research, particularly in the context of natural product chemistry and its applications in health and medicine.
Formula:C15H20O
InChI:InChI=1S/C15H20O/c1-10-5-4-6-15(3)8-14-12(7-13(10)15)11(2)9-16-14/h9,13H,1,4-8H2,2-3H3/t13-,15+/m0/s1
InChI key:InChIKey=TYPSVDGIQAOBAD-DZGCQCFKSA-N
SMILES:C[C@]12[C@@](CC3=C(C1)OC=C3C)(C(=C)CCC2)[H]
Synonyms:- (4aS,8aR)-4,4a,5,6,7,8,8a,9-Octahydro-3,8a-dimethyl-5-methylenenaphtho[2,3-b]furan
- Atractylol
- Atractylon
- Atractylone
- Atractyloxide
- Naphtho[2,3-b]furan, 4,4a,5,6,7,8,8a,9-octahydro-3,8a-dimethyl-5-methylene-, (4aS,8aR)-
- Naphtho[2,3-b]furan, 4,4a,5,6,7,8,8a,9-octahydro-3,8a-dimethyl-5-methylene-, (4aS-trans)-
- Naphtho[2,3-b]furan, 4,4aα,5,6,7,8,8a,9-octahydro-3,8aβ-dimethyl-5-methylene-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
ATRACTYLINE(DISCONTINUED)(SH)
CAS:Formula:C15H20OPurity:85%Color and Shape:SolidMolecular weight:216.3187(4aS,8aR)-3,8a-Dimethyl-5-methylene-4,4a,5,6,7,8,8a,9-octahydronaphtho[2,3-b]furan
CAS:(4aS,8aR)-3,8a-Dimethyl-5-methylene-4,4a,5,6,7,8,8a,9-octahydronaphtho[2,3-b]furanFormula:C15H20OPurity:98%Molecular weight:216.32Atractylone
CAS:Atractylone (Atractylon) has the functions of protecting liver, lowering blood sugar, antibacterial, anti-tumor and anti-virus.Formula:C15H20OPurity:99.40% - 99.99%Color and Shape:White ViscousMolecular weight:216.32Atractylon
CAS:Atractylone has inhibitory effects on mast cell-mediated allergic reactions, it regulates the degranulation of mast cell, proves its potential in the treatment of mast cell-mediated allergic reactions.Formula:C15H20OPurity:95%~99%Color and Shape:OilMolecular weight:216.324Atractylon
CAS:Atractylon is a water-soluble extract of Cimicifuga foetida that has been shown to induce apoptosis in HL-60 cells. It also inhibits the production of growth factor-β1 and caproic acid, which are important for tumor cell proliferation. Atractylon has synergistic effects with curcuma aromatica and chromatographic analysis, natural compounds, analytical method, toll-like receptor. The active ingredient in atractylon is atractylodes lancea rhizome extract.
Formula:C15H20OPurity:Min. 90 Area-%Color and Shape:White Off-White PowderMolecular weight:216.32 g/mol(4aS,8aR)-3,8a-Dimethyl-5-methylene-4,4a,5,6,7,8,8a,9-octahydronaphtho[2,3-b]furan
CAS:Formula:C15H20OPurity:98%Molecular weight:216.324






