CAS 6989-24-8
:Bayogenin
Description:
Bayogenin, with the CAS number 6989-24-8, is a naturally occurring steroidal sapogenin derived from various plant sources, particularly from the genus Dioscorea. It is characterized by its steroid structure, which includes a fused cyclopentanoperhydrophenanthrene core. Bayogenin exhibits a range of biological activities, including potential anti-inflammatory and anti-cancer properties, making it of interest in pharmacological research. The compound is typically found in the form of a white to off-white crystalline powder and is soluble in organic solvents like ethanol and chloroform, but less soluble in water. Its molecular formula reflects its complex structure, and it is often studied for its role in the biosynthesis of steroidal compounds. Additionally, bayogenin serves as a precursor for the synthesis of various pharmaceuticals and is utilized in traditional medicine. As with many steroidal compounds, its safety and efficacy in therapeutic applications are subjects of ongoing research.
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-25(2)11-13-30(24(34)35)14-12-28(5)18(19(30)15-25)7-8-22-26(3)16-20(32)23(33)27(4,17-31)21(26)9-10-29(22,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20-,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=RWNHLTKFBKYDOJ-JEERONPWSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CCC(C)(C)C4)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)([C@@](CO)(C)[C@@H](O)[C@@H](O)C5)[H])[H]
Synonyms:- (2Beta,3Beta)-2,3,23-Trihydroxyolean-12-En-28-Oic Acid
- (2beta,3beta,4alpha)-2,3,23-Trihydroxy-olean-12-en-28-oic acid
- (2β,3β,4α)-2,3,23-Trihydroxyolean-12-en-28-oic acid
- 2β,3β,23α-Trihydroxy-12-oleanen-28-oic acid
- Bayogenine
- Olean-12-en-28-oic acid, 2,3,23-trihydroxy-, (2β,3β,4α)-
- Olean-12-en-28-oic acid, 2β,3β,23-trihydroxy-
- Bayogenin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Bayogenin
CAS:Bayogenin is an alfalfa saponin, Bayogenin shows moderate potency of glycogen phosphorylase inhibition.Formula:C30H48O5Purity:99.69% - 99.76%Color and Shape:SolidMolecular weight:488.70Ref: TM-T3S1850
1mg56.00€2mg82.00€5mg126.00€10mg202.00€25mg340.00€50mg509.00€1mL*10mM (DMSO)To inquireBayogenin
CAS:Carboxylic acid with alcohol functionFormula:C30H48O5Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:488.71Bayogenin
CAS:Controlled ProductBayogenin is a steroidal sapogenin, which is a bioactive compound originating from plant sources such as certain species of the Dioscorea genus (wild yams). It is primarily extracted through processes that involve saponin hydrolysis to yield the sapogenin itself. Bayogenin, like other sapogenins, serves as a precursor in the synthesis of steroidal compounds. Its mode of action involves serving as a substrate in organic synthesis, where it facilitates the production of various steroidal drugs and hormones.Formula:C30H48O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:488.7 g/molBayogenin
CAS:Applications Bayogenin (cas# 6989-24-8) is a useful research chemical.
Formula:C30H48O5Color and Shape:NeatMolecular weight:488.7







