CAS 699-89-8

4,7-dichlorothieno[2,3-d]pyridazine

Description:

4,7-Dichlorothieno[2,3-d]pyridazine is a heterocyclic compound characterized by its fused thieno and pyridazine rings, which incorporate two chlorine substituents at the 4 and 7 positions. This compound typically exhibits a pale yellow to brown solid appearance and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique structural properties. The presence of chlorine atoms enhances its reactivity and can influence its biological activity. It is generally soluble in organic solvents, which makes it suitable for various chemical reactions and formulations. The compound's molecular structure contributes to its electronic properties, making it of interest in materials science and organic electronics. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 4,7-dichlorothieno[2,3-d]pyridazine is a significant compound in the field of synthetic organic chemistry, with ongoing research into its properties and applications.

Formula: C₆H₂Cl₂N₂S

InChI: InChI=1/C6H2Cl2N2S/c7-5-3-1-2-11-4(3)6(8)10-9-5/h1-2H

SMILES: c1csc2c1c(Cl)nnc2Cl

Synonyms:

• Thieno[2,3-D]Pyridazine, 4,7-Dichloro-
• 4,7-Dichlorothieno[2,3-d]pyridazine

4,7-Dichlorothieno[2,3-d]pyridazine

CAS: 699-89-8

Formula: C₆H₂Cl₂N₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.0645

Ref: IN-DA005GKY

4,7-Dichlorothieno[2,3-d]pyridazine

CAS: 699-89-8

4,7-Dichlorothieno[2,3-d]pyridazine

Purity: 95%

Molecular weight: 205.06g/mol

Ref: 54-OR905814

4,7-Dichlorothieno[2,3-d]pyridazine

CAS: 699-89-8

Formula: C₆H₂Cl₂N₂S

Purity: 97%

Color and Shape: Solid, No data available.

Molecular weight: 205.06

Ref: 10-F079744