CAS 699-98-9
:Furo[3,4-b]pyridine-5,7-dione
Description:
Furo[3,4-b]pyridine-5,7-dione, with the CAS number 699-98-9, is a heterocyclic organic compound characterized by its fused ring structure that incorporates both furan and pyridine moieties. This compound typically exhibits a pale yellow to brown appearance and is known for its potential biological activity, including antimicrobial and anti-inflammatory properties. The presence of the dione functional groups contributes to its reactivity, allowing for various chemical transformations. Furo[3,4-b]pyridine-5,7-dione is soluble in organic solvents, which facilitates its use in synthetic applications and research. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by substituents on the aromatic rings, which can modify its properties and enhance its utility in various chemical contexts. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C7H3NO3
InChI:InChI=1S/C7H3NO3/c9-6-4-2-1-3-8-5(4)7(10)11-6/h1-3H
InChI key:InChIKey=MCQOWYALZVKMAR-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)O1)=NC=CC2
Synonyms:- 1,3-Dioxolo[4,5-b]pyridin-2-one
- 2,3-Pyridinedicarboxylic Anhydride (Quinolinic Anhydride)
- 2,3-Pyridinedicarboxylic acid anhydride
- 2,3-PyridinedicarboxylicAcidAnhydride
- Furo[3,4-B]Pyridine-5,7-Dione
- NSC 44309
- Pyridine-2,3-Dicarboxylic Acid Anhydride
- Pyridine-2,3-dicarboxylic anhydride
- Pyridinedicarboxylicanhydride
- Pyridinic anhydride
- Quinolinic acid anhydride
- Quinolinic anhydride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3-Pyridinedicarboxylic Anhydride
CAS:Formula:C7H3NO3Purity:>95.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:149.11Pyridine-2,3-dicarboxylic anhydride, 98%
CAS:Pyridine-2,3-dicarboxylic anhydride is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information mFormula:C7H3NO3Purity:98%Color and Shape:White to pale cream, Powder or granulesMolecular weight:149.112,3-Pyridinedicarboxylicanhydride
CAS:Formula:C7H3NO3Purity:96%Color and Shape:SolidMolecular weight:149.10362,3-Pyridinedicarboxylic anhydride
CAS:2,3-Pyridinedicarboxylic anhydridePurity:98%Molecular weight:149.10g/mol2,3-Pyridinedicarboxylic anhydride
CAS:Formula:C7H3NO3Purity:95%Color and Shape:Solid, Beige powderMolecular weight:149.105





