CAS 699012-36-7

[(2R,3S,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-yl] dihydrogen phosphate

Description:

The chemical substance known as [(2R,3S,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-yl] dihydrogen phosphate, with the CAS number 699012-36-7, is a nucleotide analog that features a tetrahydrofuran ring structure. This compound is characterized by the presence of an amino purine moiety, which is significant for its potential biological activity, particularly in the context of nucleic acid metabolism. The hydroxymethyl and hydroxy groups contribute to its reactivity and solubility in aqueous environments. As a dihydrogen phosphate, it contains phosphate groups that are crucial for its role in biochemical pathways, including energy transfer and signal transduction. The stereochemistry indicated by the (2R,3S,5R) configuration suggests specific spatial arrangements that may influence its interaction with biological targets, such as enzymes or receptors. Overall, this compound's structural features position it as a potentially important molecule in medicinal chemistry and biochemistry, particularly in the development of therapeutic agents targeting nucleic acid processes.

Formula: C₁₀H₁₄N₅O₇P

InChI: InChI=1/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(17)7(4(1-16)21-10)22-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6?,7-,10-/m1/s1

SMILES: C([C@@H]1[C@H](C([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O

Adenosine 3-Monophosphate Hydrate

CAS: 699012-36-7

Formula: C₁₀H₁₆N₅O₈P

Molecular weight: 365.2365

Ref: IN-DA003NOW

(-)-Adenosine 3'-monophosphate hydrate

CAS: 699012-36-7

Adenosine 3'-monophosphate hydrate is a nucleoside that is an important intermediate in the biosynthesis of DNA and RNA. It is a phosphodiesterase inhibitor, which prevents the breakdown of adenosine 3'-monophosphate (cAMP). This compound also has a role in various other metabolic pathways, such as the synthesis of purines. Adenosine 3'-monophosphate hydrate is used for preparing adenosylcobalamin and for studies on phosphodiesterases. The nature of this compound is determined by its chemical structure, including functional groups and sequences. Its modification includes the addition of phosphate groups to its ribose sugar moiety. Adenosine 3'-monophosphate hydrate has a molecular weight of 372.4 g/mol and optimum pH of 7-8.
The hybridization behavior and ph optimum are characteristic properties of this compound.

Formula: C₁₀H₁₆N₅O₈P

Purity: Min. 95%

Molecular weight: 365.24 g/mol

Ref: 3D-NA151365