CAS 69907-67-1

trans-4-[(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl]cyclohexanecarboxylic acid

Description:

Trans-4-[(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl]cyclohexanecarboxylic acid, with the CAS number 69907-67-1, is a chemical compound characterized by its unique structural features, including a cyclohexane ring and a pyrrole derivative. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of carboxylic acid functional groups. The dioxo-pyrrole moiety contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry. The trans configuration indicates specific stereochemistry that can influence its interactions and stability. Additionally, the compound may exhibit acidic properties due to the carboxylic acid group, which can participate in hydrogen bonding and affect its solubility and reactivity in various environments. Overall, this compound's characteristics suggest potential applications in pharmaceuticals or as a building block in organic synthesis, although specific biological activities would require further investigation.

InChI: InChI=1S/C12H15NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17/h5-6,8-9H,1-4,7H2,(H,16,17)/t8-,9-

SMILES: C1C[C@@H](CC[C@H]1CN1C(=O)C=CC1=O)C(=O)O

Synonyms:

• Trans-4-(Maleimidomethyl)cyclohexanecarboxylic Acid

trans-4-(Maleimidomethyl)cyclohexanecarboxylic acid

CAS: 69907-67-1

Formula: C₁₂H₁₅NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 237.2518

Ref: IN-DA0065RD

trans-4-(N-Maleimidomethyl)cyclohexane-1-carboxylic Acid

CAS: 69907-67-1

Formula: C₁₂H₁₅NO₄

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 237.26

Ref: 3B-M3219

Mal-AMCHC

CAS: 69907-67-1

Mal-AMCHC

Formula: C₁₂H₁₅NO₄

Purity: >99%

Color and Shape: white to faint beige powder

Molecular weight: 237.2518g/mol

Ref: 54-BIBP1059

Mal-AMCHC

CAS: 69907-67-1

Formula: C₁₂H₁₅NO₄

Purity: 97%

Color and Shape: Solid, No data available.

Molecular weight: 237.255

Ref: 10-F051258

trans-4-[(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)methyl]cyclohexanecarboxylic acid

CAS: 69907-67-1

4-Maleimidomethylcyclohexanecaroboxylic acid (4MAMC) is a bifunctional molecule that is conjugated to a polymer, which has the ability to bind with cellular antigens and target tissue. It is used in clinical chemistry because it can be detected at low concentrations. 4MAMC has been shown to reduce cirrhosis caused by chronic liver injury. 4MAMC also increases the uptake of coagulation factors and decreases the expression of prothrombin, which leads to an increase in clotting time. The localization of 4MAMC is determined by the type of polymer conjugate it is bound with; for example, when it binds with human serum albumin, it localizes on the surface of cells.

Formula: C₁₂H₁₅NO₄

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 237.25 g/mol

Ref: 3D-FM54570