CAS 6991-10-2
:Swertisin
Description:
Swertisin, with the CAS number 6991-10-2, is a naturally occurring flavonoid glycoside primarily derived from various plants, particularly those in the Gentianaceae family. It is characterized by its chemical structure, which includes a flavone backbone with a sugar moiety, typically glucose or rhamnose. Swertisin exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential neuroprotective effects, making it of interest in pharmacological research. Its solubility properties are influenced by the glycosylation, which can affect its bioavailability and interaction with biological systems. Additionally, swertisin has been studied for its potential therapeutic applications in traditional medicine, particularly in treating liver disorders and other ailments. The compound's stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations in both laboratory and industrial contexts. Overall, swertisin represents a significant compound in the study of natural products and their applications in health and medicine.
Formula:C22H22O10
InChI:InChI=1S/C22H22O10/c1-30-13-7-14-16(11(25)6-12(31-14)9-2-4-10(24)5-3-9)19(27)17(13)22-21(29)20(28)18(26)15(8-23)32-22/h2-7,15,18,20-24,26-29H,8H2,1H3/t15-,18-,20+,21-,22+/m1/s1
InChI key:InChIKey=ABRULANJVVJLFI-DGHBBABESA-N
SMILES:O(C)C1=C(C(O)=C2C(=C1)OC(=CC2=O)C3=CC=C(O)C=C3)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- 4H-1-Benzopyran-4-one, 6-.beta.-d-glucopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-
- 4H-1-Benzopyran-4-one, 6-β-<span class="text-smallcaps">D</span>-glucopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-
- 6-β-<span class="text-smallcaps">D</span>-Glucopyranosyl-4′,5-dihydroxy-7-methoxyflavone
- 6-β-<span class="text-smallcaps">D</span>-Glucopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
- 7-O-Methylapigenin 6-C-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Flavocommelitin
- Genkwanin 6-C-glucoside
- NSC 641547
- Swertisin
- 6-β-D-Glucopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 6-β-D-glucopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Swertisin
CAS:Swertisin analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C22H22O10Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:446.41Swertisin
CAS:Swertisin: an herbal molecule with antihyperglycemic, antidiabetic, anti-inflammatory, and antioxidant properties; blocks adenosine A1 receptor.Formula:C22H22O10Purity:99.74% - 99.89%Color and Shape:SolidMolecular weight:446.40Swertisin
CAS:Natural glycosideFormula:C22H22O10Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:446.4Swertisin
CAS:Swertisin is a naturally occurring flavonoid, which is extracted primarily from medicinal plants like Swertia and Enicostemma species. This compound is a C-glycosyl flavone, found in various herbs traditionally used in different cultural medicinal practices. The mode of action of Swertisin involves its interaction with cellular pathways, leading to anti-inflammatory, antioxidant, and potential anti-diabetic effects. These bioactivities are primarily mediated through modulation of enzyme activity and gene expression related to oxidative stress and inflammation.
Formula:C22H22O10Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:446.4 g/molRef: 3D-FS74200
Discontinued product







