CAS 6992-39-8
:Tris(hydroxymethyl)methylammonium dihydrogen phosphate
Description:
Tris(hydroxymethyl)methylammonium dihydrogen phosphate, commonly referred to as THMP, is an organic compound characterized by its quaternary ammonium structure. It features three hydroxymethyl groups attached to a central nitrogen atom, which is also bonded to a methyl group, and is associated with a dihydrogen phosphate anion. This compound is typically used in biochemical applications, particularly as a buffering agent in biological and chemical research due to its ability to maintain stable pH levels. THMP is soluble in water, making it suitable for various aqueous applications. Its stability and compatibility with biological systems make it valuable in formulations for cell culture and other laboratory processes. Additionally, the presence of multiple hydroxymethyl groups contributes to its reactivity and potential interactions with other biomolecules. Overall, THMP is recognized for its utility in enhancing the performance of biochemical assays and maintaining optimal conditions for enzymatic reactions.
Formula:C4H11NO3·H3O4P
InChI:InChI=1S/C4H11NO3.H3O4P/c5-4(1-6,2-7)3-8;1-5(2,3)4/h6-8H,1-3,5H2;(H3,1,2,3,4)
InChI key:InChIKey=JLEXUIVKURIPFI-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)O.C(CO)(CO)(CO)N
Synonyms:- 1,3-Propanediol, 2-amino-2-(hydroxymethyl)-, phosphate (1:1)
- 1,3-Propanediol, 2-amino-2-(hydroxymethyl)-, phosphate (1:1) (salt)
- Tris phosphoric acid salt
- Tris(Hydroxymethyl)Aminomethane Phosphate
- Tris(hydroxymethyl)methylammonium dihydrogen phosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tris(Hydroxymethyl)- Aminomethane Phosphate Monobasic extrapure (Tris Phosphate Monobasic), 98%
CAS:Formula:C4H11NO3·H3PO4Purity:min 98%Color and Shape:White, Crystalline Powder, Clear, ColourlessMolecular weight:219.10Mono[tris(hydroxymethyl)aminomethane]phosphate
CAS:<p>Mono[tris(hydroxymethyl)aminomethane]phosphate is a phosphorylated derivative of inositol that is used as an analytical reagent. It binds to the intracellular Ca2+ store and can be used to measure diacylglycerol levels. Mono[tris(hydroxymethyl)aminomethane]phosphate has been shown to inhibit the release of Ca2+ from the endoplasmic reticulum, which may be due to its ability to bind to the ryanodine receptor. This drug has also been shown to induce autophagy and promote nerve growth factor synthesis, which may be due to its ability to inhibit protein kinase C and toll-like receptor signaling pathways.</p>Formula:C4H11NO3·H3PO4Purity:(Titration) Min 97%Color and Shape:White PowderMolecular weight:219.13 g/mol




