CAS 69923-95-1

5-amino-1-phenyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

Description:

5-amino-1-phenyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one, with the CAS number 69923-95-1, is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure. This compound features a phenyl group and an amino group, contributing to its potential biological activity. It typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to various pharmacological properties, including anti-inflammatory or anticancer activities. Its unique bicyclic framework allows for diverse modifications, making it a candidate for further research in drug development. As with many heterocycles, the stability and reactivity can be influenced by substituents on the aromatic ring and the nitrogen atoms in the pyrazolo and pyrimidine moieties.

Formula: C₁₁H₉N₅O

InChI: InChI=1/C11H9N5O/c12-15-7-13-10-9(11(15)17)6-14-16(10)8-4-2-1-3-5-8/h1-7H,12H2

SMILES: c1ccc(cc1)n1c2c(cn1)c(=O)n(cn2)N

Synonyms:

• 4H-pyrazolo[3,4-d]pyrimidin-4-one, 5-amino-1,5-dihydro-1-phenyl-
• 5-Amino-1-phenyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

5-Amino-1-phenyl-1H,4H,5H-pyrazolo[3,4-d]pyrimidin-4-one

CAS: 69923-95-1

Versatile small molecule scaffold

Formula: C₁₁H₉N₅O

Purity: Min. 95%

Molecular weight: 227.22 g/mol

Ref: 3D-UCA92395