CAS 69929-17-5

1-(2,4-Dimethyl-3-cyclohexen-1-yl)-2,2-dimethyl-1-propanone

Description:

1-(2,4-Dimethyl-3-cyclohexen-1-yl)-2,2-dimethyl-1-propanone, identified by its CAS number 69929-17-5, is an organic compound that belongs to the class of ketones. This substance features a complex structure characterized by a cyclohexene ring substituted with two methyl groups and a propanone moiety. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound is known for its applications in the fragrance and flavor industry, often utilized as a flavoring agent or fragrance component due to its pleasant aroma. Its chemical properties include moderate volatility and solubility in organic solvents, making it suitable for various formulations. Additionally, it may exhibit reactivity typical of ketones, such as undergoing nucleophilic addition reactions. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper use and minimize risks. Overall, this compound is notable for its unique structural features and applications in the chemical industry.

Formula: C₁₃H₂₂O

InChI: InChI=1S/C13H22O/c1-9-6-7-11(10(2)8-9)12(14)13(3,4)5/h8,10-11H,6-7H2,1-5H3

InChI key: InChIKey=ALXMEIMLYKTBHU-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)(=O)C1C(C)C=C(C)CC1

Synonyms:

• 1-(2,4-Dimethyl-3-cyclohexen-1-yl)-2,2-dimethyl-1-propanone
• 1-Propanone, 1-(2,4-dimethyl-3-cyclohexen-1-yl)-2,2-dimethyl-
• 1-(2,4-Dimethyl-3-cyclohexenyl)-2,2-dimethylpropan-1-one