CAS 6993-75-5
:Acetic acid, dimer
Description:
Acetic acid dimer, with the CAS number 6993-75-5, is a molecular compound formed by the dimerization of acetic acid molecules through hydrogen bonding. This substance typically exists in a solid state at room temperature and exhibits a crystalline structure. The dimeric form is characterized by its relatively high melting point compared to monomeric acetic acid due to the intermolecular interactions that stabilize the dimer. Acetic acid dimer is soluble in polar solvents, reflecting the polar nature of its constituent acetic acid molecules. Its chemical behavior is similar to that of acetic acid, participating in reactions typical of carboxylic acids, such as esterification and acid-base reactions. The dimerization can influence its reactivity and properties, making it an interesting subject of study in both organic chemistry and materials science. Additionally, the presence of hydrogen bonds in the dimer can affect its physical properties, such as viscosity and boiling point, compared to its monomeric counterpart.
Formula:(C2H4O2)2
InChI:InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
InChI key:InChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-N
SMILES:C(C)(O)=O
Synonyms:- Ethanoic acid dimer
- Acetic acid, dimer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
