CAS 69938-07-4
:alpha-(fluoromethyl)-3-hydroxy-L-tyrosine
Description:
Alpha-(fluoromethyl)-3-hydroxy-L-tyrosine, with the CAS number 69938-07-4, is a synthetic amino acid derivative of tyrosine, characterized by the presence of a fluoromethyl group at the alpha position and a hydroxyl group at the 3-position of the aromatic ring. This compound exhibits properties typical of amino acids, including the ability to participate in peptide bond formation and serve as a building block for proteins. The fluoromethyl group introduces unique electronic and steric properties, potentially influencing its biological activity and interactions with enzymes or receptors. The hydroxyl group enhances its solubility in polar solvents and may play a role in hydrogen bonding. This compound is of interest in medicinal chemistry and biochemistry, particularly in the study of neurotransmitter synthesis and the development of pharmaceuticals targeting neurological disorders. Its structural modifications can affect its pharmacokinetics and pharmacodynamics, making it a valuable subject for research in drug design and development.
Formula:C10H12FNO4
InChI:InChI=1/C10H12FNO4/c11-5-10(12,9(15)16)4-6-1-2-7(13)8(14)3-6/h1-3,13-14H,4-5,12H2,(H,15,16)/t10-/m1/s1
SMILES:c1cc(c(cc1C[C@@](CF)(C(=O)O)N)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.