CAS 69938-75-6
:N,N'-(benzene-1,3-diyldimethanediyl)dihexadecan-1-amine
Description:
N,N'-(benzene-1,3-diyldimethanediyl)dihexadecan-1-amine, with the CAS number 69938-75-6, is an organic compound characterized by its long hydrocarbon chains and aromatic structure. This substance features two hexadecyl (C16) amine groups attached to a central benzene ring that is further connected by a methylene bridge. The presence of the long alkyl chains contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The aromatic ring provides stability and potential for π-π interactions, which can influence its physical properties and reactivity. This compound may exhibit surfactant-like behavior due to its amphiphilic nature, which can be useful in various applications, including materials science and nanotechnology. Additionally, the presence of amine functional groups suggests potential for further chemical modifications or interactions with other substances. Overall, its unique structure combines both hydrophobic and hydrophilic characteristics, making it a compound of interest in various chemical and industrial applications.
Formula:C40H76N2
InChI:InChI=1/C40H76N2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-41-37-39-32-31-33-40(36-39)38-42-35-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h31-33,36,41-42H,3-30,34-35,37-38H2,1-2H3
SMILES:CCCCCCCCCCCCCCCCNCc1cccc(c1)CNCCCCCCCCCCCCCCCC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
CP-28888
CAS:CP-28888 (CP 28888-27) is an interferon inducer, a lipoamine with antitumor activity.Formula:C40H76N2Purity:98%Color and Shape:SolidMolecular weight:585.05CP-28888
CAS:CP-28888 is a small molecule that is an activator of G protein coupled receptors. It has been shown to inhibit the activation of ion channels and ligand-gated ion channels, as well as receptor tyrosine kinases. CP-28888 binds to the extracellular domain of the target receptors and causes a conformational change in the receptor protein that leads to downstream signaling events. CP-28888 is not an agonist but instead activates a receptor by binding to it, thereby increasing its activity. CP-28888 has been shown to inhibit cell proliferation and induce apoptosis in human cancer cells, suggesting a potential use for this drug in cancer therapy or prevention.Formula:C40H76N2Purity:Min. 95%Molecular weight:585 g/mol


