CAS 69966-50-3

N1-methyl-N1-(3-pyridylmethyl)acetamide

Description:

N1-methyl-N1-(3-pyridylmethyl)acetamide, with the CAS number 69966-50-3, is an organic compound characterized by its amide functional group, which is derived from acetic acid and contains a pyridine ring. This compound features a methyl group and a 3-pyridylmethyl substituent attached to the nitrogen atom of the amide, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the pyridine ring imparts basicity and potential for hydrogen bonding, influencing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, which can be explored in medicinal chemistry for potential therapeutic applications. As with many organic compounds, handling should be done with care, observing appropriate safety protocols to mitigate any risks associated with exposure.

Formula: C₉H₁₂N₂O

InChI: InChI=1/C9H12N2O/c1-8(12)11(2)7-9-4-3-5-10-6-9/h3-6H,7H2,1-2H3

SMILES: CC(=O)N(C)Cc1cccnc1

Synonyms:

• N-methyl-N-(pyridin-3-ylmethyl)acetamide

N-methyl-N-[(pyridin-3-yl)methyl]acetamide

CAS: 69966-50-3

Formula: C₉H₁₂N₂O

Molecular weight: 164.2044

Ref: IN-DA00653P

N-Methyl-N-[(pyridin-3-yl)methyl]acetamide

CAS: 69966-50-3

N-Methyl-N-[(pyridin-3-yl)methyl]acetamide

Purity: ≥95%

Molecular weight: 164.20g/mol

Ref: 54-OR30154

N-Methyl-N-[(pyridin-3-yl)methyl]acetamide

CAS: 69966-50-3

Versatile small molecule scaffold

Formula: C₉H₁₂N₂O

Purity: Min. 95%

Molecular weight: 164.2 g/mol

Ref: 3D-UCA96650