
CAS 69971-39-7
:Methyl 6-(hydroxymethyl)-4-methyl-2-pyridinecarboxylate
Description:
Methyl 6-(hydroxymethyl)-4-methyl-2-pyridinecarboxylate, with the CAS number 69971-39-7, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylate functional group, indicating it is an ester, specifically a methyl ester, due to the presence of a methyl group attached to the carboxylate. The hydroxymethyl group contributes to its reactivity and potential for hydrogen bonding, which can influence its solubility and interaction with other molecules. The presence of the methyl group at the 4-position of the pyridine ring can affect the compound's electronic properties and steric hindrance. Methyl 6-(hydroxymethyl)-4-methyl-2-pyridinecarboxylate may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility in synthetic chemistry. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or referenced from chemical databases.
Formula:C9H11NO3
InChI:InChI=1S/C9H11NO3/c1-6-3-7(5-11)10-8(4-6)9(12)13-2/h3-4,11H,5H2,1-2H3
InChI key:InChIKey=IZWXHNJUSVXLJH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=C(CO)C=C(C)C1
Synonyms:- Methyl 4-methyl-6-hydroxymethyl-2-pyridinecarboxylate
- 2-Pyridinecarboxylic acid, 6-(hydroxymethyl)-4-methyl-, methyl ester
- Methyl 6-(hydroxymethyl)-4-methyl-2-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
