CAS 69975-68-4
:Ac-Ala-.alpha.-naphthyl ester
Description:
Ac-Ala-.alpha.-naphthyl ester, also known as N-acetyl-L-alanine α-naphthyl ester, is a chemical compound characterized by its ester functional group, which is formed from the reaction of acetic acid and L-alanine. This compound features a naphthyl group, which contributes to its hydrophobic properties and potential applications in biochemical studies. It is typically used in peptide synthesis and as a substrate in enzymatic assays, particularly for studying the activity of serine proteases. The presence of the acetyl group enhances the stability and solubility of the molecule in organic solvents. Ac-Ala-.alpha.-naphthyl ester is generally considered to be a non-toxic compound, although handling should always be done with care in a laboratory setting. Its molecular structure allows for specific interactions with biological systems, making it a valuable tool in research related to protein function and enzyme kinetics. As with many chemical substances, proper storage and handling protocols should be followed to ensure safety and integrity.
Formula:C15H15NO3
InChI:InChI=1/C15H15NO3/c1-10(16-11(2)17)15(18)19-14-9-5-7-12-6-3-4-8-13(12)14/h3-10H,1-2H3,(H,16,17)/t10-/m0/s1
SMILES:C[C@@H](C(=O)Oc1cccc2ccccc12)N=C(C)O
Synonyms:- N-Acetylalanine alpha-naphthyl ester
- N-Acetyl-L-alanine alpha-naphthyl ester
- Naaape
- L-Alanine, N-acetyl-, 1-naphthalenyl ester
- naphthalen-1-yl N-acetyl-L-alaninate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Ac-Ala-alpha-naphthyl ester
CAS:Ac-Ala-alpha-naphthyl ester is a chemical compound that belongs to the class of aromatic esters. It is used as a research and benchmarking agent in the measurement of skin penetration potential. Ac-Ala-alpha-naphthyl ester has been shown to have good skin penetration properties, with no adverse effects on the skin.
Formula:C15H15NO3Purity:Min. 95%Molecular weight:257.28 g/molRef: 3D-FA110825
Discontinued product
