CAS 69999-15-1
:2,3-Dihydro-alpha-hydroxy-5-benzofuranacetic acid
Description:
2,3-Dihydro-alpha-hydroxy-5-benzofuranacetic acid, identified by its CAS number 69999-15-1, is a chemical compound that features a benzofuran structure, which is a fused bicyclic compound consisting of a benzene ring and a furan ring. This compound is characterized by the presence of a hydroxyl group (-OH) and an acetic acid moiety, contributing to its potential as a bioactive molecule. The dihydro configuration indicates that the compound has two hydrogen atoms added to the furan ring, which can influence its reactivity and solubility. Typically, compounds of this nature may exhibit various biological activities, including anti-inflammatory or antioxidant properties, making them of interest in medicinal chemistry. The presence of the hydroxyl group enhances its polarity, potentially affecting its interaction with biological systems. As with many organic compounds, the stability, solubility, and reactivity of 2,3-Dihydro-alpha-hydroxy-5-benzofuranacetic acid can be influenced by environmental factors such as pH and temperature.
Formula:C10H10O4
InChI:InChI=1S/C10H10O4/c11-9(10(12)13)7-1-2-8-6(5-7)3-4-14-8/h1-2,5,9,11H,3-4H2,(H,12,13)
SMILES:c1cc2c(CCO2)cc1C(C(=O)O)O
Synonyms:- 2,3-Dihydro-Α-Hydroxy-5-Benzofuranacetic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.