CAS 70-09-7: 2-chloro-N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,4-dicarboxamide
Description:The chemical substance known as 2-chloro-N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,4-dicarboxamide, with the CAS number 70-09-7, is a complex organic compound characterized by its dual amide functional groups and a chloro substituent. This compound features a central benzene ring substituted with two dicarboxamide groups and two 4-(4,5-dihydro-1H-imidazol-2-yl)phenyl moieties, contributing to its potential biological activity. The presence of the imidazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The chloro group may influence the compound's reactivity and solubility. Typically, such compounds exhibit moderate to high molecular weights and can be synthesized through multi-step organic reactions. Their properties, including solubility, melting point, and stability, can vary significantly based on the specific structural features and substituents. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C26H23ClN6O2
InChI:InChI=1/C26H23ClN6O2/c27-22-15-18(25(34)32-19-6-1-16(2-7-19)23-28-11-12-29-23)5-10-21(22)26(35)33-20-8-3-17(4-9-20)24-30-13-14-31-24/h1-10,15H,11-14H2,(H,28,29)(H,30,31)(H,32,34)(H,33,35)