CAS 70-09-7

2-chloro-N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,4-dicarboxamide

Description:

The chemical substance known as 2-chloro-N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,4-dicarboxamide, with the CAS number 70-09-7, is a complex organic compound characterized by its dual amide functional groups and a chloro substituent. This compound features a central benzene ring substituted with two dicarboxamide groups and two 4-(4,5-dihydro-1H-imidazol-2-yl)phenyl moieties, contributing to its potential biological activity. The presence of the imidazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The chloro group may influence the compound's reactivity and solubility. Typically, such compounds exhibit moderate to high molecular weights and can be synthesized through multi-step organic reactions. Their properties, including solubility, melting point, and stability, can vary significantly based on the specific structural features and substituents. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₂₆H₂₃ClN₆O₂

InChI: InChI=1/C26H23ClN6O2/c27-22-15-18(25(34)32-19-6-1-16(2-7-19)23-28-11-12-29-23)5-10-21(22)26(35)33-20-8-3-17(4-9-20)24-30-13-14-31-24/h1-10,15H,11-14H2,(H,28,29)(H,30,31)(H,32,34)(H,33,35)

SMILES: c1cc(ccc1C1=NCCN1)NC(=O)c1ccc(c(c1)Cl)C(=O)Nc1ccc(cc1)C1=NCCN1

NSC-60339

CAS: 70-09-7

NSC-60339: AcrAB-TolC substrate, efflux pump inhibitor, potential cancer drug.

Formula: C₂₆H₂₃ClN₆O₂

Purity: 98.78%

Color and Shape: Solid

Molecular weight: 486.95

Ref: TM-T16349

NSC-60339

CAS: 70-09-7

Formula: C₂₆H₂₃ClN₆O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 486.9528

Ref: IN-DA01V4EZ

NSC-60339

CAS: 70-09-7

NSC-60339

Purity: ≥95%

Molecular weight: 486.95g/mol

Ref: 54-BUP09475

2-Chloro-N1,N4-bis(4-(4,5-dihydro-1H-imidazol-2-yl)phenyl)terephthalamide

CAS: 70-09-7

Purity: 98%

Molecular weight: 486.959991455078

Ref: 10-F867905

NSC-60339

CAS: 70-09-7

NSC-60339 is a synthetic antineoplastic agent derived from laboratory synthesis known for its targeted inhibition of specific cancer cell pathways. The compound operates by interfering with crucial cellular processes such as DNA replication or protein synthesis, depending on its exact mode of action.

Formula: C₂₆H₂₃ClN₆O₂

Purity: Min. 95%

Molecular weight: 487 g/mol

Ref: 3D-AAA07009