CAS 700-07-2
:N-methyl-2,1-benzothiazol-3-amine
Description:
N-methyl-2,1-benzothiazol-3-amine, with the CAS number 700-07-2, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a methyl group attached to the nitrogen atom of the amine functional group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. N-methyl-2,1-benzothiazol-3-amine is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, owing to its biological activity. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data indicates that, like many amines, it should be handled with care, as it may pose health risks upon exposure. Proper safety measures, including the use of personal protective equipment, are recommended when working with this substance.
Formula:C8H8N2S
InChI:InChI=1/C8H8N2S/c1-9-8-6-4-2-3-5-7(6)10-11-8/h2-5,9H,1H3
Synonyms:- 2,1-benzisothiazol-3-amine, N-methyl-
- N-Methyl-2,1-benzothiazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
