CAS 700-16-3
:Pentafluoropyridine
Description:
Pentafluoropyridine is a fluorinated heterocyclic compound characterized by the presence of five fluorine atoms attached to a pyridine ring. Its molecular formula is C5F5N, and it is known for its high reactivity and unique properties due to the electronegative fluorine substituents. This compound is typically a colorless liquid at room temperature and has a distinctive odor. Pentafluoropyridine is soluble in organic solvents and is often used as a reagent in organic synthesis, particularly in the preparation of fluorinated compounds and pharmaceuticals. Its strong electron-withdrawing fluorine atoms enhance its acidity and reactivity, making it a valuable intermediate in various chemical reactions. Additionally, pentafluoropyridine is noted for its stability under a range of conditions, although it can react with strong nucleophiles. Safety precautions are necessary when handling this compound due to its potential toxicity and environmental impact. Overall, pentafluoropyridine is an important compound in the field of synthetic organic chemistry and materials science.
Formula:C5F5N
InChI:InChI=1S/C5F5N/c6-1-2(7)4(9)11-5(10)3(1)8
InChI key:InChIKey=XTGOWLIKIQLYRG-UHFFFAOYSA-N
SMILES:FC=1C(F)=C(F)C(F)=NC1F
Synonyms:- 2,3,4,5,6-Pentafluoropyridine
- 3-(Trifluoromethyl)Furan-2,5-Dione
- Perfluoropyridine
- Pyridine, 2,3,4,5,6-pentafluoro-
- Pyridine, pentafluoro-
- Pentafluoropyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Pentafluoropyridine, 99%
CAS:Pentafluoropyridine was used in the preparation of 2-C,C coordinated pentafluoropyridine complex. It was also used in the preparation of polyfluorinated coupling products via Pd(0)-catalyzed cross-coupling reaction with diarylzinc compounds. It was also used as derivatizing reagent in the sensitiveFormula:C5F5NPurity:99%Color and Shape:Liquid, Clear colorlessMolecular weight:169.05Ref: IN-DA0035GN
1kgTo inquire5kgTo inquire500gTo inquire1g22.00€5g25.00€10g40.00€25g60.00€100g177.00€2,3,4,5,6-Pentafluoropyridine
CAS:2,3,4,5,6-PentafluoropyridineFormula:C5F5NPurity:99%Color and Shape: clear. almost colourless liquidMolecular weight:169.05221g/molPentafluoropyridine
CAS:Formula:C5F5NPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:169.05Pentafluoropyridine, 99%
CAS:Pentafluoropyridine, 99%
Formula:C5F5NPurity:99%Color and Shape:colorless liq.Molecular weight:169.05Pentafluoropyridine
CAS:Controlled ProductApplications Pentafluoropyridine (cas# 700-16-3) is a useful research chemical.
Formula:C5F5NColor and Shape:NeatMolecular weight:169.05






