CAS 700-17-4
:2,3,5,6-Tetrafluorobenzenamine
Description:
2,3,5,6-Tetrafluorobenzenamine, with the CAS number 700-17-4, is an aromatic amine characterized by the presence of four fluorine atoms substituted on a benzene ring, specifically at the 2, 3, 5, and 6 positions, along with an amino group (-NH2). This compound is typically a colorless to pale yellow solid at room temperature and is known for its relatively high stability due to the strong C-F bonds. The fluorine substituents significantly influence its chemical properties, including increased electronegativity and altered reactivity compared to non-fluorinated analogs. It is soluble in organic solvents and may exhibit limited solubility in water. 2,3,5,6-Tetrafluorobenzenamine is utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fluorinated compounds. Due to the presence of the amino group, it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H3F4N
InChI:InChI=1S/C6H3F4N/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,11H2
InChI key:InChIKey=SPSWJTZNOXMMMV-UHFFFAOYSA-N
SMILES:FC1=C(N)C(F)=C(F)C=C1F
Synonyms:- 2,3,5,6-Tetrafluorobenzenamine
- 2,3,5,6-Tetrafluorophenylamine
- Aniline, 2,3,5,6-tetrafluoro-
- Benzenamine, 2,3,5,6-tetrafluoro-
- NSC 88347
- Tetrafluoroaniline3
- 2,3,5,6-Tetrafluoroaniline
- 2,3,5,6-Tetrafluoraniline
- 2,3,5,6-Tetrafluoroaniline98%
- 2,3,5,6-Tetrafluoroaniline 98%
- 1-Amino-2,3,5,6-tetrafluorobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3,5,6-Tetrafluoroaniline
CAS:Formula:C6H3F4NPurity:>97.0%(GC)Color and Shape:White or Colorless to Light orange to Yellow powder to lump to clear liquidMolecular weight:165.092,3,5,6-Tetrafluoroaniline
CAS:Formula:C6H3F4NPurity:98%Color and Shape:SolidMolecular weight:165.08832,3,5,6-Tetrafluoroaniline
CAS:Formula:C6H3F4NPurity:95.0%Color and Shape:Solid, Low Melting SolidMolecular weight:165.0912,3,5,6-Tetrafluoroaniline
CAS:2,3,5,6-Tetrafluoroaniline is a methyl derivative of 2,3,5,6-tetrafluoroaniline. The decarboxylated form is used in medicines to synthesize proton pump inhibitors such as Rofecoxib and Omeprazole. 2,3,5,6-Tetrafluoroaniline is synthesized by the reaction of ammonium persulfate with deionized water and carbon tetrachloride. This reaction produces an intermediate that then undergoes a cross-coupling reaction with a substituted phenylboronic acid to produce the desired product. The nmr spectra of this compound show that it has a double bond between C2 and C3.Formula:C6H3F4NPurity:Min. 95%Molecular weight:165.09 g/mol2,3,5,6-Tetrafluoroaniline
CAS:2,3,5,6-TetrafluoroanilineFormula:C6H3F4NPurity:98%Color and Shape: white fused solidMolecular weight:165.09g/mol





