CAS 700-48-1
:4,6-Dibromobenzothiazole
Description:
4,6-Dibromobenzothiazole is an organic compound characterized by its heterocyclic structure, which includes a benzothiazole moiety substituted with bromine atoms at the 4 and 6 positions. This compound typically appears as a solid and is known for its pale yellow to brown color. It is soluble in organic solvents such as acetone and chloroform but has limited solubility in water. The presence of bromine atoms enhances its reactivity and can impart antimicrobial properties, making it useful in various applications, including as a biocide and in the synthesis of other chemical compounds. Additionally, 4,6-Dibromobenzothiazole is of interest in materials science and organic synthesis due to its potential as a building block for more complex molecules. However, safety considerations are important, as it may pose environmental and health risks, necessitating careful handling and disposal. Overall, this compound exemplifies the diverse functionality of halogenated heterocycles in chemical research and industrial applications.
Formula:C7H3Br2NS
InChI:InChI=1S/C7H3Br2NS/c8-4-1-5(9)7-6(2-4)11-3-10-7/h1-3H
InChI key:InChIKey=IIQFYLMDHBRKCK-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(Br)=C1)SC=N2
Synonyms:- 4,6-Dibromobenzothiazole
- Benzothiazole, 4,6-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4,6-Dibromobenzothiazole
CAS:Controlled ProductFormula:C7H3Br2NSColor and Shape:NeatMolecular weight:292.978
