CAS 700-96-9
:3,4-Dimethoxythiophenol
Description:
3,4-Dimethoxythiophenol, with the CAS number 700-96-9, is an organic compound characterized by the presence of a thiophenol group substituted with two methoxy groups at the 3 and 4 positions of the aromatic ring. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The methoxy groups enhance its solubility in organic solvents and may influence its electronic properties, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the presence of the thiol group can impart unique properties, such as antioxidant activity. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards.
Formula:C8H10O2S
InChI:InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3
SMILES:COc1ccc(cc1OC)S
Synonyms:- 3,4-Dimethoxybenzenethiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Dimethoxybenzenethiol
CAS:Formula:C8H10O2SPurity:98%Color and Shape:LiquidMolecular weight:170.22883,4-Dimethoxythiophenol
CAS:3,4-Dimethoxythiophenol is a chemical compound that is used as a fluorescence probe to study biological functions in cells. It reacts with hydroxyl groups and other reactive sites on proteins, including sulfhydryl groups, thiols, and amines. 3,4-Dimethoxythiophenol has been shown to inhibit the viability of cancer cells (e.g., prostate cancer cells) by interfering with the function of dehydrogenase enzymes. 3,4-Dimethoxythiophenol also inhibits growth of microglia (cells that protect neurons) in vitro. This inhibition is due to the production of reactive oxygen species by the microglial cells. The chemical structure of this compound includes a hydroxyl group and two methoxy groups.Formula:C8H10O2SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:170.23 g/mol



